C16H17BrF2NO2SY- — CID 153451132
3-bromo-1-(2,2-difluoroethyl)-6-[2-methyl-4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451132) has the molecular formula C16H17BrF2NO2SY- and a molecular weight of 494.19 g/mol. Its IUPAC name is 3-bromo-1-(2,2-difluoroethyl)-6-[2-methyl-4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 3-bromo-1-(2,2-difluoroethyl)-6-[2-methyl-4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451132 |
| Molecular Formula | C16H17BrF2NO2SY- |
| Molecular Weight | 494.19 g/mol |
| Exact Mass | 492.92 |
| IUPAC Name | 3-bromo-1-(2,2-difluoroethyl)-6-[2-methyl-4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CSCOc1ccc(C2=[C-]CC(Br)C(=O)N2CC(F)F)c(C)c1.[Y] |
| InChI | InChI=1S/C16H17BrF2NO2S.Y/c1-10-7-11(22-9-23-2)3-4-12(10)14-6-5-13(17)16(21)20(14)8-15(18)19;/h3-4,7,13,15H,5,8-9H2,1-2H3;/q-1; |
| InChIKey | HXJJETIOHMSQPD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|