C16H16F4NO2SY- — CID 153451397
1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451397) has the molecular formula C16H16F4NO2SY- and a molecular weight of 451.27 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451397 |
| Molecular Formula | C16H16F4NO2SY- |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CSCOc1cc(F)c(C2=[C-]CC(C)C(=O)N2CC(F)F)c(F)c1.[Y] |
| InChI | InChI=1S/C16H16F4NO2S.Y/c1-9-3-4-13(21(16(9)22)7-14(19)20)15-11(17)5-10(6-12(15)18)23-8-24-2;/h5-6,9,14H,3,7-8H2,1-2H3;/q-1; |
| InChIKey | UDAUWCIEPNREDE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|