C17H15BrF2NO2Y- — CID 153452019
6-(2-bromo-4-prop-2-ynoxyphenyl)-1-(2,2-difluoroethyl)-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153452019) has the molecular formula C17H15BrF2NO2Y- and a molecular weight of 472.12 g/mol. Its IUPAC name is 6-(2-bromo-4-prop-2-ynoxyphenyl)-1-(2,2-difluoroethyl)-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 6-(2-bromo-4-prop-2-ynoxyphenyl)-1-(2,2-difluoroethyl)-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153452019 |
| Molecular Formula | C17H15BrF2NO2Y- |
| Molecular Weight | 472.12 g/mol |
| Exact Mass | 470.93 |
| IUPAC Name | 6-(2-bromo-4-prop-2-ynoxyphenyl)-1-(2,2-difluoroethyl)-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | C#CCOc1ccc(C2=[C-]CC(C)C(=O)N2CC(F)F)c(Br)c1.[Y] |
| InChI | InChI=1S/C17H15BrF2NO2.Y/c1-3-8-23-12-5-6-13(14(18)9-12)15-7-4-11(2)17(22)21(15)10-16(19)20;/h1,5-6,9,11,16H,4,8,10H2,2H3;/q-1; |
| InChIKey | JYCJYLQCGRWAAJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.12 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|