C15H12BrF2N2O2Y- — CID 153450818
2-[3-bromo-4-[1-(2,2-difluoroethyl)-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium (PubChem CID 153450818) has the molecular formula C15H12BrF2N2O2Y- and a molecular weight of 459.08 g/mol. Its IUPAC name is 2-[3-bromo-4-[1-(2,2-difluoroethyl)-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium.
| Compound Name | 2-[3-bromo-4-[1-(2,2-difluoroethyl)-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium |
|---|---|
| PubChem CID | 153450818 |
| Molecular Formula | C15H12BrF2N2O2Y- |
| Molecular Weight | 459.08 g/mol |
| Exact Mass | 457.91 |
| IUPAC Name | 2-[3-bromo-4-[1-(2,2-difluoroethyl)-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium |
| SMILES | N#CCOc1ccc(C2=[C-]CCC(=O)N2CC(F)F)c(Br)c1.[Y] |
| InChI | InChI=1S/C15H12BrF2N2O2.Y/c16-12-8-10(22-7-6-19)4-5-11(12)13-2-1-3-15(21)20(13)9-14(17)18;/h4-5,8,14H,1,3,7,9H2;/q-1; |
| InChIKey | SREYMQJXNGIWEQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|