C16H15BrF2NO2Y- — CID 153450986
6-(2-bromo-4-prop-2-enoxyphenyl)-1-(2,2-difluoroethyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153450986) has the molecular formula C16H15BrF2NO2Y- and a molecular weight of 460.11 g/mol. Its IUPAC name is 6-(2-bromo-4-prop-2-enoxyphenyl)-1-(2,2-difluoroethyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 6-(2-bromo-4-prop-2-enoxyphenyl)-1-(2,2-difluoroethyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153450986 |
| Molecular Formula | C16H15BrF2NO2Y- |
| Molecular Weight | 460.11 g/mol |
| Exact Mass | 458.93 |
| IUPAC Name | 6-(2-bromo-4-prop-2-enoxyphenyl)-1-(2,2-difluoroethyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | C=CCOc1ccc(C2=[C-]CCC(=O)N2CC(F)F)c(Br)c1.[Y] |
| InChI | InChI=1S/C16H15BrF2NO2.Y/c1-2-8-22-11-6-7-12(13(17)9-11)14-4-3-5-16(21)20(14)10-15(18)19;/h2,6-7,9,15H,1,3,5,8,10H2;/q-1; |
| InChIKey | KVLYRUPMUYNOFX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.11 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|