C18H17F3NOY- — CID 158191537
1-(2,2-difluoroethyl)-2-(2-fluoro-4-prop-2-enoxyphenyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 158191537) has the molecular formula C18H17F3NOY- and a molecular weight of 409.24 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2-(2-fluoro-4-prop-2-enoxyphenyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-2-(2-fluoro-4-prop-2-enoxyphenyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 158191537 |
| Molecular Formula | C18H17F3NOY- |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2-(2-fluoro-4-prop-2-enoxyphenyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=CCOc1ccc(C2=[C-]C=C(C)C(=C)N2CC(F)F)c(F)c1.[Y] |
| InChI | InChI=1S/C18H17F3NO.Y/c1-4-9-23-14-6-7-15(16(19)10-14)17-8-5-12(2)13(3)22(17)11-18(20)21;/h4-7,10,18H,1,3,9,11H2,2H3;/q-1; |
| InChIKey | XOUOCOMPCMJKAY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|