C18H17FNOY- — CID 160771850
1-ethyl-2-(2-fluoro-4-prop-2-ynoxyphenyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 160771850) has the molecular formula C18H17FNOY- and a molecular weight of 371.24 g/mol. Its IUPAC name is 1-ethyl-2-(2-fluoro-4-prop-2-ynoxyphenyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 1-ethyl-2-(2-fluoro-4-prop-2-ynoxyphenyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 160771850 |
| Molecular Formula | C18H17FNOY- |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 1-ethyl-2-(2-fluoro-4-prop-2-ynoxyphenyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C#CCOc1ccc(C2=[C-]C=C(C)C(=C)N2CC)c(F)c1.[Y] |
| InChI | InChI=1S/C18H17FNO.Y/c1-5-11-21-15-8-9-16(17(19)12-15)18-10-7-13(3)14(4)20(18)6-2;/h1,7-9,12H,4,6,11H2,2-3H3;/q-1; |
| InChIKey | UPLJZULDJVESQO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|