C16H16BrFNOY- — CID 159017015
5-bromo-2-(2-fluoro-4-propoxyphenyl)-1-methyl-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 159017015) has the molecular formula C16H16BrFNOY- and a molecular weight of 426.12 g/mol. Its IUPAC name is 5-bromo-2-(2-fluoro-4-propoxyphenyl)-1-methyl-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 5-bromo-2-(2-fluoro-4-propoxyphenyl)-1-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 159017015 |
| Molecular Formula | C16H16BrFNOY- |
| Molecular Weight | 426.12 g/mol |
| Exact Mass | 424.95 |
| IUPAC Name | 5-bromo-2-(2-fluoro-4-propoxyphenyl)-1-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(Br)=C[C-]=C(c2ccc(OCCC)cc2F)N1C.[Y] |
| InChI | InChI=1S/C16H16BrFNO.Y/c1-4-9-20-12-5-6-13(15(18)10-12)16-8-7-14(17)11(2)19(16)3;/h5-7,10H,2,4,9H2,1,3H3;/q-1; |
| InChIKey | LOWOSFIAOJRQML-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.12 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|