C17H19ClFNO2 — CID 159372256
3-chloro-1-ethyl-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-2-methylidenepyridine (PubChem CID 159372256) has the molecular formula C17H19ClFNO2 and a molecular weight of 323.80 g/mol. Its IUPAC name is 3-chloro-1-ethyl-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-2-methylidenepyridine.
| Compound Name | 3-chloro-1-ethyl-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-2-methylidenepyridine |
|---|---|
| PubChem CID | 159372256 |
| Molecular Formula | C17H19ClFNO2 |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 3-chloro-1-ethyl-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-2-methylidenepyridine |
| SMILES | C=C1C(Cl)=CC=C(c2ccc(OCCOC)cc2F)N1CC |
| InChI | InChI=1S/C17H19ClFNO2/c1-4-20-12(2)15(18)7-8-17(20)14-6-5-13(11-16(14)19)22-10-9-21-3/h5-8,11H,2,4,9-10H2,1,3H3 |
| InChIKey | CYXGTLFQLLNQSQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|