C16H15ClF3NOS — CID 159934092
3-chloro-1-(2,2-difluoroethyl)-6-[2-fluoro-4-(methylsulfanylmethoxy)phenyl]-2-methylidenepyridine (PubChem CID 159934092) has the molecular formula C16H15ClF3NOS and a molecular weight of 361.82 g/mol. Its IUPAC name is 3-chloro-1-(2,2-difluoroethyl)-6-[2-fluoro-4-(methylsulfanylmethoxy)phenyl]-2-methylidenepyridine.
| Compound Name | 3-chloro-1-(2,2-difluoroethyl)-6-[2-fluoro-4-(methylsulfanylmethoxy)phenyl]-2-methylidenepyridine |
|---|---|
| PubChem CID | 159934092 |
| Molecular Formula | C16H15ClF3NOS |
| Molecular Weight | 361.82 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 3-chloro-1-(2,2-difluoroethyl)-6-[2-fluoro-4-(methylsulfanylmethoxy)phenyl]-2-methylidenepyridine |
| SMILES | C=C1C(Cl)=CC=C(c2ccc(OCSC)cc2F)N1CC(F)F |
| InChI | InChI=1S/C16H15ClF3NOS/c1-10-13(17)5-6-15(21(10)8-16(19)20)12-4-3-11(7-14(12)18)22-9-23-2/h3-7,16H,1,8-9H2,2H3 |
| InChIKey | QAHFTRSSQZABIZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|