C17H16ClF3NO2Y- — CID 161316716
5-chloro-1-(2,2-difluoroethyl)-2-[2-fluoro-4-(2-methoxyethoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 161316716) has the molecular formula C17H16ClF3NO2Y- and a molecular weight of 447.67 g/mol. Its IUPAC name is 5-chloro-1-(2,2-difluoroethyl)-2-[2-fluoro-4-(2-methoxyethoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 5-chloro-1-(2,2-difluoroethyl)-2-[2-fluoro-4-(2-methoxyethoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 161316716 |
| Molecular Formula | C17H16ClF3NO2Y- |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | 5-chloro-1-(2,2-difluoroethyl)-2-[2-fluoro-4-(2-methoxyethoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(Cl)=C[C-]=C(c2ccc(OCCOC)cc2F)N1CC(F)F.[Y] |
| InChI | InChI=1S/C17H16ClF3NO2.Y/c1-11-14(18)5-6-16(22(11)10-17(20)21)13-4-3-12(9-15(13)19)24-8-7-23-2;/h3-5,9,17H,1,7-8,10H2,2H3;/q-1; |
| InChIKey | HYIYLZLWXKKZLK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|