C14H9ClF4NY- — CID 161494243
5-chloro-1-(2,2-difluoroethyl)-2-(3,5-difluorophenyl)-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 161494243) has the molecular formula C14H9ClF4NY- and a molecular weight of 391.58 g/mol. Its IUPAC name is 5-chloro-1-(2,2-difluoroethyl)-2-(3,5-difluorophenyl)-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 5-chloro-1-(2,2-difluoroethyl)-2-(3,5-difluorophenyl)-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 161494243 |
| Molecular Formula | C14H9ClF4NY- |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | 5-chloro-1-(2,2-difluoroethyl)-2-(3,5-difluorophenyl)-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(Cl)=C[C-]=C(c2cc(F)cc(F)c2)N1CC(F)F.[Y] |
| InChI | InChI=1S/C14H9ClF4N.Y/c1-8-12(15)2-3-13(20(8)7-14(18)19)9-4-10(16)6-11(17)5-9;/h2,4-6,14H,1,7H2;/q-1; |
| InChIKey | PLZOQJXVWCAJCR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|