C15H14F2NOY- — CID 158882257
4-[1-(2,2-difluoroethyl)-5-methyl-6-methylidene-3H-pyridin-3-id-2-yl]phenol;yttrium (PubChem CID 158882257) has the molecular formula C15H14F2NOY- and a molecular weight of 351.19 g/mol. Its IUPAC name is 4-[1-(2,2-difluoroethyl)-5-methyl-6-methylidene-3H-pyridin-3-id-2-yl]phenol;yttrium.
| Compound Name | 4-[1-(2,2-difluoroethyl)-5-methyl-6-methylidene-3H-pyridin-3-id-2-yl]phenol;yttrium |
|---|---|
| PubChem CID | 158882257 |
| Molecular Formula | C15H14F2NOY- |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 4-[1-(2,2-difluoroethyl)-5-methyl-6-methylidene-3H-pyridin-3-id-2-yl]phenol;yttrium |
| SMILES | C=C1C(C)=C[C-]=C(c2ccc(O)cc2)N1CC(F)F.[Y] |
| InChI | InChI=1S/C15H14F2NO.Y/c1-10-3-8-14(12-4-6-13(19)7-5-12)18(11(10)2)9-15(16)17;/h3-7,15,19H,2,9H2,1H3;/q-1; |
| InChIKey | PXARSWUNACLEAG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|