C19H16F2NOY- — CID 158178771
1-(2,2-difluoroethyl)-5-ethynyl-6-methylidene-2-(4-prop-2-enoxyphenyl)-3H-pyridin-3-ide;yttrium (PubChem CID 158178771) has the molecular formula C19H16F2NOY- and a molecular weight of 401.25 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-5-ethynyl-6-methylidene-2-(4-prop-2-enoxyphenyl)-3H-pyridin-3-ide;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-5-ethynyl-6-methylidene-2-(4-prop-2-enoxyphenyl)-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 158178771 |
| Molecular Formula | C19H16F2NOY- |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 1-(2,2-difluoroethyl)-5-ethynyl-6-methylidene-2-(4-prop-2-enoxyphenyl)-3H-pyridin-3-ide;yttrium |
| SMILES | C#CC1=C[C-]=C(c2ccc(OCC=C)cc2)N(CC(F)F)C1=C.[Y] |
| InChI | InChI=1S/C19H16F2NO.Y/c1-4-12-23-17-9-6-16(7-10-17)18-11-8-15(5-2)14(3)22(18)13-19(20)21;/h2,4,6-10,19H,1,3,12-13H2;/q-1; |
| InChIKey | WYEYQYHUBWDURW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|