C18H19F2INO2Y- — CID 160772540
1-(2,2-difluoroethyl)-5-iodo-2-[4-(3-methoxypropoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 160772540) has the molecular formula C18H19F2INO2Y- and a molecular weight of 535.16 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-5-iodo-2-[4-(3-methoxypropoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-5-iodo-2-[4-(3-methoxypropoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 160772540 |
| Molecular Formula | C18H19F2INO2Y- |
| Molecular Weight | 535.16 g/mol |
| Exact Mass | 534.95 |
| IUPAC Name | 1-(2,2-difluoroethyl)-5-iodo-2-[4-(3-methoxypropoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(I)=C[C-]=C(c2ccc(OCCCOC)cc2)N1CC(F)F.[Y] |
| InChI | InChI=1S/C18H19F2INO2.Y/c1-13-16(21)8-9-17(22(13)12-18(19)20)14-4-6-15(7-5-14)24-11-3-10-23-2;/h4-8,18H,1,3,10-12H2,2H3;/q-1; |
| InChIKey | VDMOHRNVWREXQH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|