C19H24NO2Y- — CID 160820868
1-ethyl-2-[4-(3-methoxypropoxy)phenyl]-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 160820868) has the molecular formula C19H24NO2Y- and a molecular weight of 387.31 g/mol. Its IUPAC name is 1-ethyl-2-[4-(3-methoxypropoxy)phenyl]-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 1-ethyl-2-[4-(3-methoxypropoxy)phenyl]-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 160820868 |
| Molecular Formula | C19H24NO2Y- |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-ethyl-2-[4-(3-methoxypropoxy)phenyl]-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(C)=C[C-]=C(c2ccc(OCCCOC)cc2)N1CC.[Y] |
| InChI | InChI=1S/C19H24NO2.Y/c1-5-20-16(3)15(2)7-12-19(20)17-8-10-18(11-9-17)22-14-6-13-21-4;/h7-11H,3,5-6,13-14H2,1-2,4H3;/q-1; |
| InChIKey | OCGSSABNUXHJDX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|