C15H15ClNOY- — CID 157409502
5-chloro-2-(4-ethoxyphenyl)-1-methyl-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 157409502) has the molecular formula C15H15ClNOY- and a molecular weight of 349.65 g/mol. Its IUPAC name is 5-chloro-2-(4-ethoxyphenyl)-1-methyl-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 5-chloro-2-(4-ethoxyphenyl)-1-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 157409502 |
| Molecular Formula | C15H15ClNOY- |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 5-chloro-2-(4-ethoxyphenyl)-1-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(Cl)=C[C-]=C(c2ccc(OCC)cc2)N1C.[Y] |
| InChI | InChI=1S/C15H15ClNO.Y/c1-4-18-13-7-5-12(6-8-13)15-10-9-14(16)11(2)17(15)3;/h5-9H,2,4H2,1,3H3;/q-1; |
| InChIKey | BYDIOPICNLDGFC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|