C16H18NOY- — CID 153086018
2-(4-ethoxyphenyl)-1,5-dimethyl-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 153086018) has the molecular formula C16H18NOY- and a molecular weight of 329.23 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1,5-dimethyl-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 2-(4-ethoxyphenyl)-1,5-dimethyl-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 153086018 |
| Molecular Formula | C16H18NOY- |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1,5-dimethyl-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(C)=C[C-]=C(c2ccc(OCC)cc2)N1C.[Y] |
| InChI | InChI=1S/C16H18NO.Y/c1-5-18-15-9-7-14(8-10-15)16-11-6-12(2)13(3)17(16)4;/h6-10H,3,5H2,1-2,4H3;/q-1; |
| InChIKey | OXVYHCAZYFKGLM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|