C18H20F2NO2Y- — CID 159431424
2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 159431424) has the molecular formula C18H20F2NO2Y- and a molecular weight of 409.27 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 159431424 |
| Molecular Formula | C18H20F2NO2Y- |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1-ethyl-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(C)=C[C-]=C(c2c(F)cc(OCCOC)cc2F)N1CC.[Y] |
| InChI | InChI=1S/C18H20F2NO2.Y/c1-5-21-13(3)12(2)6-7-17(21)18-15(19)10-14(11-16(18)20)23-9-8-22-4;/h6,10-11H,3,5,8-9H2,1-2,4H3;/q-1; |
| InChIKey | GQRJQTOPYCLERC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|