C16H16BrFNO2Y- — CID 162077228
5-bromo-1-ethyl-2-[2-fluoro-4-(methoxymethoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 162077228) has the molecular formula C16H16BrFNO2Y- and a molecular weight of 442.12 g/mol. Its IUPAC name is 5-bromo-1-ethyl-2-[2-fluoro-4-(methoxymethoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 5-bromo-1-ethyl-2-[2-fluoro-4-(methoxymethoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 162077228 |
| Molecular Formula | C16H16BrFNO2Y- |
| Molecular Weight | 442.12 g/mol |
| Exact Mass | 440.94 |
| IUPAC Name | 5-bromo-1-ethyl-2-[2-fluoro-4-(methoxymethoxy)phenyl]-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(Br)=C[C-]=C(c2ccc(OCOC)cc2F)N1CC.[Y] |
| InChI | InChI=1S/C16H16BrFNO2.Y/c1-4-19-11(2)14(17)7-8-16(19)13-6-5-12(9-15(13)18)21-10-20-3;/h5-7,9H,2,4,10H2,1,3H3;/q-1; |
| InChIKey | JMRHSFZTUPBTPU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.12 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|