C15H12ClF3NY- — CID 159756936
2-(4-chloro-2-fluorophenyl)-1-(2,2-difluoroethyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 159756936) has the molecular formula C15H12ClF3NY- and a molecular weight of 387.62 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-1-(2,2-difluoroethyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-1-(2,2-difluoroethyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 159756936 |
| Molecular Formula | C15H12ClF3NY- |
| Molecular Weight | 387.62 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-1-(2,2-difluoroethyl)-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(C)=C[C-]=C(c2ccc(Cl)cc2F)N1CC(F)F.[Y] |
| InChI | InChI=1S/C15H12ClF3N.Y/c1-9-3-6-14(20(10(9)2)8-15(18)19)12-5-4-11(16)7-13(12)17;/h3-5,7,15H,2,8H2,1H3;/q-1; |
| InChIKey | WZTACVBKIHFRLM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|