C14H10Cl2F2NY- — CID 162169593
2-(2,4-dichlorophenyl)-1-(2,2-difluoroethyl)-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 162169593) has the molecular formula C14H10Cl2F2NY- and a molecular weight of 390.05 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(2,2-difluoroethyl)-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(2,2-difluoroethyl)-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 162169593 |
| Molecular Formula | C14H10Cl2F2NY- |
| Molecular Weight | 390.05 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(2,2-difluoroethyl)-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C=C[C-]=C(c2ccc(Cl)cc2Cl)N1CC(F)F.[Y] |
| InChI | InChI=1S/C14H10Cl2F2N.Y/c1-9-3-2-4-13(19(9)8-14(17)18)11-6-5-10(15)7-12(11)16;/h2-3,5-7,14H,1,8H2;/q-1; |
| InChIKey | BPGSVXHZSFUKKM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.05 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|