C13H9BrClF2INOY- — CID 153450784
6-(2-bromo-4-chlorophenyl)-1-(2,2-difluoroethyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153450784) has the molecular formula C13H9BrClF2INOY- and a molecular weight of 564.38 g/mol. Its IUPAC name is 6-(2-bromo-4-chlorophenyl)-1-(2,2-difluoroethyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 6-(2-bromo-4-chlorophenyl)-1-(2,2-difluoroethyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153450784 |
| Molecular Formula | C13H9BrClF2INOY- |
| Molecular Weight | 564.38 g/mol |
| Exact Mass | 562.76 |
| IUPAC Name | 6-(2-bromo-4-chlorophenyl)-1-(2,2-difluoroethyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | O=C1C(I)C[C-]=C(c2ccc(Cl)cc2Br)N1CC(F)F.[Y] |
| InChI | InChI=1S/C13H9BrClF2INO.Y/c14-9-5-7(15)1-2-8(9)11-4-3-10(18)13(20)19(11)6-12(16)17;/h1-2,5,10,12H,3,6H2;/q-1; |
| InChIKey | OASQJOZDIARFFT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|