C15H15ClF2NO2Y- — CID 153450860
3-chloro-1-(2,2-difluoroethyl)-6-(4-methoxy-2-methylphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153450860) has the molecular formula C15H15ClF2NO2Y- and a molecular weight of 403.65 g/mol. Its IUPAC name is 3-chloro-1-(2,2-difluoroethyl)-6-(4-methoxy-2-methylphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 3-chloro-1-(2,2-difluoroethyl)-6-(4-methoxy-2-methylphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153450860 |
| Molecular Formula | C15H15ClF2NO2Y- |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 3-chloro-1-(2,2-difluoroethyl)-6-(4-methoxy-2-methylphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | COc1ccc(C2=[C-]CC(Cl)C(=O)N2CC(F)F)c(C)c1.[Y] |
| InChI | InChI=1S/C15H15ClF2NO2.Y/c1-9-7-10(21-2)3-4-11(9)13-6-5-12(16)15(20)19(13)8-14(17)18;/h3-4,7,12,14H,5,8H2,1-2H3;/q-1; |
| InChIKey | NECAPSBRMGLPHG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|