C15H14Cl2F2NO3Y- — CID 153451621
3-chloro-6-[2-chloro-4-(methoxymethoxy)phenyl]-1-(2,2-difluoroethyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451621) has the molecular formula C15H14Cl2F2NO3Y- and a molecular weight of 454.09 g/mol. Its IUPAC name is 3-chloro-6-[2-chloro-4-(methoxymethoxy)phenyl]-1-(2,2-difluoroethyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 3-chloro-6-[2-chloro-4-(methoxymethoxy)phenyl]-1-(2,2-difluoroethyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451621 |
| Molecular Formula | C15H14Cl2F2NO3Y- |
| Molecular Weight | 454.09 g/mol |
| Exact Mass | 452.94 |
| IUPAC Name | 3-chloro-6-[2-chloro-4-(methoxymethoxy)phenyl]-1-(2,2-difluoroethyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | COCOc1ccc(C2=[C-]CC(Cl)C(=O)N2CC(F)F)c(Cl)c1.[Y] |
| InChI | InChI=1S/C15H14Cl2F2NO3.Y/c1-22-8-23-9-2-3-10(12(17)6-9)13-5-4-11(16)15(21)20(13)7-14(18)19;/h2-3,6,11,14H,4,7-8H2,1H3;/q-1; |
| InChIKey | PCDHFCHHDKPIMI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.09 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|