C16H18BrClNO3Y- — CID 153450340
6-[2-bromo-4-(2-methoxyethoxy)phenyl]-3-chloro-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153450340) has the molecular formula C16H18BrClNO3Y- and a molecular weight of 476.59 g/mol. Its IUPAC name is 6-[2-bromo-4-(2-methoxyethoxy)phenyl]-3-chloro-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 6-[2-bromo-4-(2-methoxyethoxy)phenyl]-3-chloro-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153450340 |
| Molecular Formula | C16H18BrClNO3Y- |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 474.92 |
| IUPAC Name | 6-[2-bromo-4-(2-methoxyethoxy)phenyl]-3-chloro-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CCN1C(=O)C(Cl)C[C-]=C1c1ccc(OCCOC)cc1Br.[Y] |
| InChI | InChI=1S/C16H18BrClNO3.Y/c1-3-19-15(7-6-14(18)16(19)20)12-5-4-11(10-13(12)17)22-9-8-21-2;/h4-5,10,14H,3,6,8-9H2,1-2H3;/q-1; |
| InChIKey | XVOUEZBBJKCRRB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|