C13H11BrCl2NOY- — CID 153451459
6-(2-bromo-4-chlorophenyl)-3-chloro-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451459) has the molecular formula C13H11BrCl2NOY- and a molecular weight of 436.95 g/mol. Its IUPAC name is 6-(2-bromo-4-chlorophenyl)-3-chloro-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 6-(2-bromo-4-chlorophenyl)-3-chloro-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451459 |
| Molecular Formula | C13H11BrCl2NOY- |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 434.85 |
| IUPAC Name | 6-(2-bromo-4-chlorophenyl)-3-chloro-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CCN1C(=O)C(Cl)C[C-]=C1c1ccc(Cl)cc1Br.[Y] |
| InChI | InChI=1S/C13H11BrCl2NO.Y/c1-2-17-12(6-5-11(16)13(17)18)9-4-3-8(15)7-10(9)14;/h3-4,7,11H,2,5H2,1H3;/q-1; |
| InChIKey | JZVGJERUXSKFEK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|