C15H18NO2Y- — CID 153450608
1-ethyl-6-(4-hydroxy-2-methylphenyl)-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153450608) has the molecular formula C15H18NO2Y- and a molecular weight of 333.22 g/mol. Its IUPAC name is 1-ethyl-6-(4-hydroxy-2-methylphenyl)-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 1-ethyl-6-(4-hydroxy-2-methylphenyl)-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153450608 |
| Molecular Formula | C15H18NO2Y- |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 1-ethyl-6-(4-hydroxy-2-methylphenyl)-3-methyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CCN1C(=O)C(C)C[C-]=C1c1ccc(O)cc1C.[Y] |
| InChI | InChI=1S/C15H18NO2.Y/c1-4-16-14(8-5-10(2)15(16)18)13-7-6-12(17)9-11(13)3;/h6-7,9-10,17H,4-5H2,1-3H3;/q-1; |
| InChIKey | SXBIFKQALJZFQV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|