C14H13BrNO2Y- — CID 157387497
5-bromo-1-ethyl-2-(4-hydroxy-2-methylphenyl)-3H-pyridin-3-id-6-one;yttrium (PubChem CID 157387497) has the molecular formula C14H13BrNO2Y- and a molecular weight of 396.07 g/mol. Its IUPAC name is 5-bromo-1-ethyl-2-(4-hydroxy-2-methylphenyl)-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 5-bromo-1-ethyl-2-(4-hydroxy-2-methylphenyl)-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 157387497 |
| Molecular Formula | C14H13BrNO2Y- |
| Molecular Weight | 396.07 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | 5-bromo-1-ethyl-2-(4-hydroxy-2-methylphenyl)-3H-pyridin-3-id-6-one;yttrium |
| SMILES | CCn1c(-c2ccc(O)cc2C)[c-]cc(Br)c1=O.[Y] |
| InChI | InChI=1S/C14H13BrNO2.Y/c1-3-16-13(7-6-12(15)14(16)18)11-5-4-10(17)8-9(11)2;/h4-6,8,17H,3H2,1-2H3;/q-1; |
| InChIKey | POYAYQRBEXZUDI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.07 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|