C16H12BrClNO2Y- — CID 158882413
2-(2-bromo-4-prop-2-ynoxyphenyl)-5-chloro-1-ethyl-3H-pyridin-3-id-6-one;yttrium (PubChem CID 158882413) has the molecular formula C16H12BrClNO2Y- and a molecular weight of 454.54 g/mol. Its IUPAC name is 2-(2-bromo-4-prop-2-ynoxyphenyl)-5-chloro-1-ethyl-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 2-(2-bromo-4-prop-2-ynoxyphenyl)-5-chloro-1-ethyl-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 158882413 |
| Molecular Formula | C16H12BrClNO2Y- |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 452.88 |
| IUPAC Name | 2-(2-bromo-4-prop-2-ynoxyphenyl)-5-chloro-1-ethyl-3H-pyridin-3-id-6-one;yttrium |
| SMILES | C#CCOc1ccc(-c2[c-]cc(Cl)c(=O)n2CC)c(Br)c1.[Y] |
| InChI | InChI=1S/C16H12BrClNO2.Y/c1-3-9-21-11-5-6-12(13(17)10-11)15-8-7-14(18)16(20)19(15)4-2;/h1,5-7,10H,4,9H2,2H3;/q-1; |
| InChIKey | IKJMIQPSAZUBBS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|