C14H9Cl2N2O2Y- — CID 161194488
2-[3-chloro-4-(5-chloro-1-methyl-6-oxo-3H-pyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium (PubChem CID 161194488) has the molecular formula C14H9Cl2N2O2Y- and a molecular weight of 397.05 g/mol. Its IUPAC name is 2-[3-chloro-4-(5-chloro-1-methyl-6-oxo-3H-pyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium.
| Compound Name | 2-[3-chloro-4-(5-chloro-1-methyl-6-oxo-3H-pyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium |
|---|---|
| PubChem CID | 161194488 |
| Molecular Formula | C14H9Cl2N2O2Y- |
| Molecular Weight | 397.05 g/mol |
| Exact Mass | 395.91 |
| IUPAC Name | 2-[3-chloro-4-(5-chloro-1-methyl-6-oxo-3H-pyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium |
| SMILES | Cn1c(-c2ccc(OCC#N)cc2Cl)[c-]cc(Cl)c1=O.[Y] |
| InChI | InChI=1S/C14H9Cl2N2O2.Y/c1-18-13(5-4-11(15)14(18)19)10-3-2-9(8-12(10)16)20-7-6-17;/h2-4,8H,7H2,1H3;/q-1; |
| InChIKey | ZZVPQOSSGZOJRC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.05 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|