C12H7Cl2INOY- — CID 160520589
2-(2,4-dichlorophenyl)-5-iodo-1-methyl-3H-pyridin-3-id-6-one;yttrium (PubChem CID 160520589) has the molecular formula C12H7Cl2INOY- and a molecular weight of 467.91 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-iodo-1-methyl-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 2-(2,4-dichlorophenyl)-5-iodo-1-methyl-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 160520589 |
| Molecular Formula | C12H7Cl2INOY- |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 466.80 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-iodo-1-methyl-3H-pyridin-3-id-6-one;yttrium |
| SMILES | Cn1c(-c2ccc(Cl)cc2Cl)[c-]cc(I)c1=O.[Y] |
| InChI | InChI=1S/C12H7Cl2INO.Y/c1-16-11(5-4-10(15)12(16)17)8-3-2-7(13)6-9(8)14;/h2-4,6H,1H3;/q-1; |
| InChIKey | KFGLVOLGGWXFTK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|