C14H10Cl2F2NOY- — CID 159462140
5-chloro-2-(4-chloro-2-methylphenyl)-1-(2,2-difluoroethyl)-3H-pyridin-3-id-6-one;yttrium (PubChem CID 159462140) has the molecular formula C14H10Cl2F2NOY- and a molecular weight of 406.05 g/mol. Its IUPAC name is 5-chloro-2-(4-chloro-2-methylphenyl)-1-(2,2-difluoroethyl)-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 5-chloro-2-(4-chloro-2-methylphenyl)-1-(2,2-difluoroethyl)-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 159462140 |
| Molecular Formula | C14H10Cl2F2NOY- |
| Molecular Weight | 406.05 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | 5-chloro-2-(4-chloro-2-methylphenyl)-1-(2,2-difluoroethyl)-3H-pyridin-3-id-6-one;yttrium |
| SMILES | Cc1cc(Cl)ccc1-c1[c-]cc(Cl)c(=O)n1CC(F)F.[Y] |
| InChI | InChI=1S/C14H10Cl2F2NO.Y/c1-8-6-9(15)2-3-10(8)12-5-4-11(16)14(20)19(12)7-13(17)18;/h2-4,6,13H,7H2,1H3;/q-1; |
| InChIKey | WAECMRJHPANXEI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.05 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|