C18H14F4NO2Y- — CID 146788159
2-(4-but-2-ynoxy-2,6-difluorophenyl)-1-(2,2-difluoroethyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium (PubChem CID 146788159) has the molecular formula C18H14F4NO2Y- and a molecular weight of 441.21 g/mol. Its IUPAC name is 2-(4-but-2-ynoxy-2,6-difluorophenyl)-1-(2,2-difluoroethyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 2-(4-but-2-ynoxy-2,6-difluorophenyl)-1-(2,2-difluoroethyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 146788159 |
| Molecular Formula | C18H14F4NO2Y- |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | 2-(4-but-2-ynoxy-2,6-difluorophenyl)-1-(2,2-difluoroethyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium |
| SMILES | CC#CCOc1cc(F)c(-c2[c-]cc(C)c(=O)n2CC(F)F)c(F)c1.[Y] |
| InChI | InChI=1S/C18H14F4NO2.Y/c1-3-4-7-25-12-8-13(19)17(14(20)9-12)15-6-5-11(2)18(24)23(15)10-16(21)22;/h5,8-9,16H,7,10H2,1-2H3;/q-1; |
| InChIKey | VPFJFRDYFXYAOY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|