C16H11BrF4NO2Y- — CID 158796468
5-bromo-1-(2,2-difluoroethyl)-2-(2,6-difluoro-4-prop-2-enoxyphenyl)-3H-pyridin-3-id-6-one;yttrium (PubChem CID 158796468) has the molecular formula C16H11BrF4NO2Y- and a molecular weight of 494.07 g/mol. Its IUPAC name is 5-bromo-1-(2,2-difluoroethyl)-2-(2,6-difluoro-4-prop-2-enoxyphenyl)-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 5-bromo-1-(2,2-difluoroethyl)-2-(2,6-difluoro-4-prop-2-enoxyphenyl)-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 158796468 |
| Molecular Formula | C16H11BrF4NO2Y- |
| Molecular Weight | 494.07 g/mol |
| Exact Mass | 492.90 |
| IUPAC Name | 5-bromo-1-(2,2-difluoroethyl)-2-(2,6-difluoro-4-prop-2-enoxyphenyl)-3H-pyridin-3-id-6-one;yttrium |
| SMILES | C=CCOc1cc(F)c(-c2[c-]cc(Br)c(=O)n2CC(F)F)c(F)c1.[Y] |
| InChI | InChI=1S/C16H11BrF4NO2.Y/c1-2-5-24-9-6-11(18)15(12(19)7-9)13-4-3-10(17)16(23)22(13)8-14(20)21;/h2-3,6-7,14H,1,5,8H2;/q-1; |
| InChIKey | VUQMJYYTBVRNCU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.07 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|