C16H14ClF4NO2 — CID 153451650
3-chloro-1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-prop-2-enoxyphenyl)-3,4-dihydropyridin-2-one (PubChem CID 153451650) has the molecular formula C16H14ClF4NO2 and a molecular weight of 363.74 g/mol. Its IUPAC name is 3-chloro-1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-prop-2-enoxyphenyl)-3,4-dihydropyridin-2-one.
| Compound Name | 3-chloro-1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-prop-2-enoxyphenyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451650 |
| Molecular Formula | C16H14ClF4NO2 |
| Molecular Weight | 363.74 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 3-chloro-1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-prop-2-enoxyphenyl)-3,4-dihydropyridin-2-one |
| SMILES | C=CCOc1cc(F)c(C2=CCC(Cl)C(=O)N2CC(F)F)c(F)c1 |
| InChI | InChI=1S/C16H14ClF4NO2/c1-2-5-24-9-6-11(18)15(12(19)7-9)13-4-3-10(17)16(23)22(13)8-14(20)21/h2,4,6-7,10,14H,1,3,5,8H2 |
| InChIKey | LAOKWPPNUZSYQW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|