About 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile
2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile (PubChem CID 153451297) has the molecular formula C14H11ClF2N2O2
and a molecular weight of 312.70 g/mol. Its IUPAC name is 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile |
| PubChem CID | 153451297 |
| Molecular Formula | C14H11ClF2N2O2 |
| Molecular Weight | 312.70 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile |
| SMILES | CN1C(=O)C(Cl)CC=C1c1c(F)cc(OCC#N)cc1F |
| InChI | InChI=1S/C14H11ClF2N2O2/c1-19-12(3-2-9(15)14(19)20)13-10(16)6-8(7-11(13)17)21-5-4-18/h3,6-7,9H,2,5H2,1H3 |
| InChIKey | FXBGQBBDUQKLRV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.70 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile?
The IUPAC name of 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile (CID 153451297) is 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile.
What is the SMILES notation for 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile?
The canonical SMILES for 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile is CN1C(=O)C(Cl)CC=C1c1c(F)cc(OCC#N)cc1F.
What is the InChIKey of 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile?
The InChIKey is FXBGQBBDUQKLRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClF2N2O2/c1-19-12(3-2-9(15)14(19)20)13-10(16)6-8(7-11(13)17)21-5-4-18/h3,6-7,9H,2,5H2,1H3.
What are the key properties of 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile?
2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile has a molecular weight of 312.70 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-chloro-1-methyl-2-oxo-3,4-dihydropyridin-6-yl)-3,5-difluorophenoxy]acetonitrile is sourced from PubChem (CID 153451297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).