C17H19F2NO2 — CID 153450471
6-(2,6-difluoro-4-prop-2-enoxyphenyl)-1-ethyl-3-methyl-3,4-dihydropyridin-2-one (PubChem CID 153450471) has the molecular formula C17H19F2NO2 and a molecular weight of 307.34 g/mol. Its IUPAC name is 6-(2,6-difluoro-4-prop-2-enoxyphenyl)-1-ethyl-3-methyl-3,4-dihydropyridin-2-one.
| Compound Name | 6-(2,6-difluoro-4-prop-2-enoxyphenyl)-1-ethyl-3-methyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153450471 |
| Molecular Formula | C17H19F2NO2 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 6-(2,6-difluoro-4-prop-2-enoxyphenyl)-1-ethyl-3-methyl-3,4-dihydropyridin-2-one |
| SMILES | C=CCOc1cc(F)c(C2=CCC(C)C(=O)N2CC)c(F)c1 |
| InChI | InChI=1S/C17H19F2NO2/c1-4-8-22-12-9-13(18)16(14(19)10-12)15-7-6-11(3)17(21)20(15)5-2/h4,7,9-11H,1,5-6,8H2,2-3H3 |
| InChIKey | CXWWBWCZKAKAIT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|