C14H8F2IN2O2Y- — CID 158307649
2-[3,5-difluoro-4-(5-iodo-1-methyl-6-oxo-3H-pyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium (PubChem CID 158307649) has the molecular formula C14H8F2IN2O2Y- and a molecular weight of 490.04 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(5-iodo-1-methyl-6-oxo-3H-pyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium.
| Compound Name | 2-[3,5-difluoro-4-(5-iodo-1-methyl-6-oxo-3H-pyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium |
|---|---|
| PubChem CID | 158307649 |
| Molecular Formula | C14H8F2IN2O2Y- |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.87 |
| IUPAC Name | 2-[3,5-difluoro-4-(5-iodo-1-methyl-6-oxo-3H-pyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium |
| SMILES | Cn1c(-c2c(F)cc(OCC#N)cc2F)[c-]cc(I)c1=O.[Y] |
| InChI | InChI=1S/C14H8F2IN2O2.Y/c1-19-12(3-2-11(17)14(19)20)13-9(15)6-8(7-10(13)16)21-5-4-18;/h2,6-7H,5H2,1H3;/q-1; |
| InChIKey | RYJNVHUPWKODCV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|