C13H10ClF4NO2 — CID 153452084
3-chloro-1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-hydroxyphenyl)-3,4-dihydropyridin-2-one (PubChem CID 153452084) has the molecular formula C13H10ClF4NO2 and a molecular weight of 323.67 g/mol. Its IUPAC name is 3-chloro-1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-hydroxyphenyl)-3,4-dihydropyridin-2-one.
| Compound Name | 3-chloro-1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-hydroxyphenyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153452084 |
| Molecular Formula | C13H10ClF4NO2 |
| Molecular Weight | 323.67 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 3-chloro-1-(2,2-difluoroethyl)-6-(2,6-difluoro-4-hydroxyphenyl)-3,4-dihydropyridin-2-one |
| SMILES | O=C1C(Cl)CC=C(c2c(F)cc(O)cc2F)N1CC(F)F |
| InChI | InChI=1S/C13H10ClF4NO2/c14-7-1-2-10(19(13(7)21)5-11(17)18)12-8(15)3-6(20)4-9(12)16/h2-4,7,11,20H,1,5H2 |
| InChIKey | DKHIXVDKRHLPSM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|