C16H16F4INO3 — CID 153450451
1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-3-iodo-3,4-dihydropyridin-2-one (PubChem CID 153450451) has the molecular formula C16H16F4INO3 and a molecular weight of 473.20 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-3-iodo-3,4-dihydropyridin-2-one.
| Compound Name | 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-3-iodo-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153450451 |
| Molecular Formula | C16H16F4INO3 |
| Molecular Weight | 473.20 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-3-iodo-3,4-dihydropyridin-2-one |
| SMILES | COCCOc1cc(F)c(C2=CCC(I)C(=O)N2CC(F)F)c(F)c1 |
| InChI | InChI=1S/C16H16F4INO3/c1-24-4-5-25-9-6-10(17)15(11(18)7-9)13-3-2-12(21)16(23)22(13)8-14(19)20/h3,6-7,12,14H,2,4-5,8H2,1H3 |
| InChIKey | HNGLIVFIWFBMDV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|