C15H15F4NO2S — CID 153451782
1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3,4-dihydropyridin-2-one (PubChem CID 153451782) has the molecular formula C15H15F4NO2S and a molecular weight of 349.35 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3,4-dihydropyridin-2-one.
| Compound Name | 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451782 |
| Molecular Formula | C15H15F4NO2S |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-[2,6-difluoro-4-(methylsulfanylmethoxy)phenyl]-3,4-dihydropyridin-2-one |
| SMILES | CSCOc1cc(F)c(C2=CCCC(=O)N2CC(F)F)c(F)c1 |
| InChI | InChI=1S/C15H15F4NO2S/c1-23-8-22-9-5-10(16)15(11(17)6-9)12-3-2-4-14(21)20(12)7-13(18)19/h3,5-6,13H,2,4,7-8H2,1H3 |
| InChIKey | KOHKRAIFICWQTB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|