C17H16ClF2NO2 — CID 153450943
6-(4-but-2-ynoxy-2-chlorophenyl)-1-(2,2-difluoroethyl)-3,4-dihydropyridin-2-one (PubChem CID 153450943) has the molecular formula C17H16ClF2NO2 and a molecular weight of 339.77 g/mol. Its IUPAC name is 6-(4-but-2-ynoxy-2-chlorophenyl)-1-(2,2-difluoroethyl)-3,4-dihydropyridin-2-one.
| Compound Name | 6-(4-but-2-ynoxy-2-chlorophenyl)-1-(2,2-difluoroethyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153450943 |
| Molecular Formula | C17H16ClF2NO2 |
| Molecular Weight | 339.77 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 6-(4-but-2-ynoxy-2-chlorophenyl)-1-(2,2-difluoroethyl)-3,4-dihydropyridin-2-one |
| SMILES | CC#CCOc1ccc(C2=CCCC(=O)N2CC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C17H16ClF2NO2/c1-2-3-9-23-12-7-8-13(14(18)10-12)15-5-4-6-17(22)21(15)11-16(19)20/h5,7-8,10,16H,4,6,9,11H2,1H3 |
| InChIKey | PMSVXGSRKDSSPR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|