C17H15ClFNO2 — CID 149123787
6-(4-but-2-ynoxy-2-fluorophenyl)-3-chloro-1-ethylpyridin-2-one (PubChem CID 149123787) has the molecular formula C17H15ClFNO2 and a molecular weight of 319.76 g/mol. Its IUPAC name is 6-(4-but-2-ynoxy-2-fluorophenyl)-3-chloro-1-ethylpyridin-2-one.
| Compound Name | 6-(4-but-2-ynoxy-2-fluorophenyl)-3-chloro-1-ethylpyridin-2-one |
|---|---|
| PubChem CID | 149123787 |
| Molecular Formula | C17H15ClFNO2 |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 6-(4-but-2-ynoxy-2-fluorophenyl)-3-chloro-1-ethylpyridin-2-one |
| SMILES | CC#CCOc1ccc(-c2ccc(Cl)c(=O)n2CC)c(F)c1 |
| InChI | InChI=1S/C17H15ClFNO2/c1-3-5-10-22-12-6-7-13(15(19)11-12)16-9-8-14(18)17(21)20(16)4-2/h6-9,11H,4,10H2,1-2H3 |
| InChIKey | DNXVJWCLVWNQRG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|