C18H15F2INO2Y- — CID 159380388
2-(4-but-2-ynoxy-2-methylphenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium (PubChem CID 159380388) has the molecular formula C18H15F2INO2Y- and a molecular weight of 531.13 g/mol. Its IUPAC name is 2-(4-but-2-ynoxy-2-methylphenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 2-(4-but-2-ynoxy-2-methylphenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 159380388 |
| Molecular Formula | C18H15F2INO2Y- |
| Molecular Weight | 531.13 g/mol |
| Exact Mass | 530.92 |
| IUPAC Name | 2-(4-but-2-ynoxy-2-methylphenyl)-1-(2,2-difluoroethyl)-5-iodo-3H-pyridin-3-id-6-one;yttrium |
| SMILES | CC#CCOc1ccc(-c2[c-]cc(I)c(=O)n2CC(F)F)c(C)c1.[Y] |
| InChI | InChI=1S/C18H15F2INO2.Y/c1-3-4-9-24-13-5-6-14(12(2)10-13)16-8-7-15(21)18(23)22(16)11-17(19)20;/h5-7,10,17H,9,11H2,1-2H3;/q-1; |
| InChIKey | DMHYPULMUYDUHB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|