C16H15F3NO2Y- — CID 158969829
1-(2,2-difluoroethyl)-2-(4-ethoxy-2-fluorophenyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium (PubChem CID 158969829) has the molecular formula C16H15F3NO2Y- and a molecular weight of 399.20 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2-(4-ethoxy-2-fluorophenyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-2-(4-ethoxy-2-fluorophenyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 158969829 |
| Molecular Formula | C16H15F3NO2Y- |
| Molecular Weight | 399.20 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2-(4-ethoxy-2-fluorophenyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium |
| SMILES | CCOc1ccc(-c2[c-]cc(C)c(=O)n2CC(F)F)c(F)c1.[Y] |
| InChI | InChI=1S/C16H15F3NO2.Y/c1-3-22-11-5-6-12(13(17)8-11)14-7-4-10(2)16(21)20(14)9-15(18)19;/h4-6,8,15H,3,9H2,1-2H3;/q-1; |
| InChIKey | UPYLBYDFFRWJAV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.20 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|