C15H14BrClNO2Y- — CID 158259101
5-bromo-2-(2-chloro-4-ethoxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium (PubChem CID 158259101) has the molecular formula C15H14BrClNO2Y- and a molecular weight of 444.55 g/mol. Its IUPAC name is 5-bromo-2-(2-chloro-4-ethoxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 5-bromo-2-(2-chloro-4-ethoxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 158259101 |
| Molecular Formula | C15H14BrClNO2Y- |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 442.90 |
| IUPAC Name | 5-bromo-2-(2-chloro-4-ethoxyphenyl)-1-ethyl-3H-pyridin-3-id-6-one;yttrium |
| SMILES | CCOc1ccc(-c2[c-]cc(Br)c(=O)n2CC)c(Cl)c1.[Y] |
| InChI | InChI=1S/C15H14BrClNO2.Y/c1-3-18-14(8-7-12(16)15(18)19)11-6-5-10(20-4-2)9-13(11)17;/h5-7,9H,3-4H2,1-2H3;/q-1; |
| InChIKey | UBYAWCAZHAIDGM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|