C18H16F2NO2Y- — CID 159983160
2-(4-but-2-ynoxyphenyl)-1-(2,2-difluoroethyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium (PubChem CID 159983160) has the molecular formula C18H16F2NO2Y- and a molecular weight of 405.23 g/mol. Its IUPAC name is 2-(4-but-2-ynoxyphenyl)-1-(2,2-difluoroethyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 2-(4-but-2-ynoxyphenyl)-1-(2,2-difluoroethyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 159983160 |
| Molecular Formula | C18H16F2NO2Y- |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 2-(4-but-2-ynoxyphenyl)-1-(2,2-difluoroethyl)-5-methyl-3H-pyridin-3-id-6-one;yttrium |
| SMILES | CC#CCOc1ccc(-c2[c-]cc(C)c(=O)n2CC(F)F)cc1.[Y] |
| InChI | InChI=1S/C18H16F2NO2.Y/c1-3-4-11-23-15-8-6-14(7-9-15)16-10-5-13(2)18(22)21(16)12-17(19)20;/h5-9,17H,11-12H2,1-2H3;/q-1; |
| InChIKey | BIIJFOHJXHDOOA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|