C15H16NO2SY- — CID 159764361
1,5-dimethyl-2-[4-(methylsulfanylmethoxy)phenyl]-3H-pyridin-3-id-6-one;yttrium (PubChem CID 159764361) has the molecular formula C15H16NO2SY- and a molecular weight of 363.27 g/mol. Its IUPAC name is 1,5-dimethyl-2-[4-(methylsulfanylmethoxy)phenyl]-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 1,5-dimethyl-2-[4-(methylsulfanylmethoxy)phenyl]-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 159764361 |
| Molecular Formula | C15H16NO2SY- |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 1,5-dimethyl-2-[4-(methylsulfanylmethoxy)phenyl]-3H-pyridin-3-id-6-one;yttrium |
| SMILES | CSCOc1ccc(-c2[c-]cc(C)c(=O)n2C)cc1.[Y] |
| InChI | InChI=1S/C15H16NO2S.Y/c1-11-4-9-14(16(2)15(11)17)12-5-7-13(8-6-12)18-10-19-3;/h4-8H,10H2,1-3H3;/q-1; |
| InChIKey | WBWCVEJTGQMQKM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|