C15H18NO2SY- — CID 153451669
1-ethyl-6-[4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451669) has the molecular formula C15H18NO2SY- and a molecular weight of 365.29 g/mol. Its IUPAC name is 1-ethyl-6-[4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 1-ethyl-6-[4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451669 |
| Molecular Formula | C15H18NO2SY- |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 1-ethyl-6-[4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CCN1C(=O)CC[C-]=C1c1ccc(OCSC)cc1.[Y] |
| InChI | InChI=1S/C15H18NO2S.Y/c1-3-16-14(5-4-6-15(16)17)12-7-9-13(10-8-12)18-11-19-2;/h7-10H,3-4,6,11H2,1-2H3;/q-1; |
| InChIKey | YNKBBXZDXFCKPY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|